CAS 93745-74-5 appears in our catalog under these names: Venetoclax Impurity 13, 3-Chloro-4-nitrobenzene-1-sulfonamide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
3-chloro-4-nitrobenzenesulfonamide (CAS 93745-74-5) is a chemical compound with the molecular formula C6H5ClN2O4S and a molecular weight of 236.63 g/mol. IUPAC name: 3-chloro-4-nitrobenzenesulfonamide. InChIKey: GSRVYSLJJHIICB-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O4S |
|---|---|
| Molecular weight | 236.63 g/mol |
| IUPAC name | 3-chloro-4-nitrobenzenesulfonamide |
| InChIKey | GSRVYSLJJHIICB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)