CAS 2064219-23-2 is the registry number for Avibactam Impurity 88. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (CAS 2064219-23-2) is a chemical compound with the molecular formula C7H11N3O6S and a molecular weight of 265.25 g/mol. IUPAC name: [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate. InChIKey: NDCUAPJVLWFHHB-RFZPGFLSSA-N.
| Molecular formula | C7H11N3O6S |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| InChIKey | NDCUAPJVLWFHHB-RFZPGFLSSA-N |
| SMILES | C1C[C@@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)O)C(=O)N |
Computed by PubChem (NCBI)