Products 2064219-23-2

CAS 2064219-23-2 is the registry number for Avibactam Impurity 88. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (CAS 2064219-23-2) is a chemical compound with the molecular formula C7H11N3O6S and a molecular weight of 265.25 g/mol. IUPAC name: [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate. InChIKey: NDCUAPJVLWFHHB-RFZPGFLSSA-N.

Identity
Molecular formulaC7H11N3O6S
Molecular weight265.25 g/mol
IUPAC name[(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate
InChIKeyNDCUAPJVLWFHHB-RFZPGFLSSA-N
SMILESC1C[C@@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)O)C(=O)N

Computed by PubChem (NCBI)