CAS 2064219-25-4 appears in our catalog under these names: Avibactam Impurity 87, Avibactam Impurity 74. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,5S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (CAS 2064219-25-4) is a chemical compound with the molecular formula C7H11N3O6S and a molecular weight of 265.25 g/mol. IUPAC name: [(2S,5S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate. InChIKey: NDCUAPJVLWFHHB-WHFBIAKZSA-N.
| Molecular formula | C7H11N3O6S |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | [(2S,5S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| InChIKey | NDCUAPJVLWFHHB-WHFBIAKZSA-N |
| SMILES | C1C[C@H](N2C[C@H]1N(C2=O)OS(=O)(=O)O)C(=O)N |
Computed by PubChem (NCBI)