CAS 2065-37-4 appears in our catalog under these names: 2-Bromo-1,4-naphthoquinone, >95% (HPLC), 2–Bromonaphthalene–1,4–dione, 2-Bromo-1,4-naphthoquinone, 2-Bromonaphthalene-1,4-dione 97%, 2-BROMO-1,4-NAPHTHOQUINONE, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 500mg, 10g, 5g, 0,25g, 2,5g, 25g, 100g.
2-bromonaphthalene-1,4-dione (CAS 2065-37-4) is a chemical compound with the molecular formula C10H5BrO2 and a molecular weight of 237.05 g/mol. IUPAC name: 2-bromonaphthalene-1,4-dione. InChIKey: KJOHPBJYGGFYBJ-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO2 |
|---|---|
| Molecular weight | 237.05 g/mol |
| IUPAC name | 2-bromonaphthalene-1,4-dione |
| InChIKey | KJOHPBJYGGFYBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(C2=O)Br |
Computed by PubChem (NCBI)