CAS 6954-48-9 appears in our catalog under these names: 6-Bromonaphthalene-1,2-dione, 95%, Bonafton/ 97.16% (existing batch purity), Bonaphthone, 6-Bromonaphthalene-1,2-dione, Bonaphthone, 97.16%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.
6-bromonaphthalene-1,2-dione (CAS 6954-48-9) is a chemical compound with the molecular formula C10H5BrO2 and a molecular weight of 237.05 g/mol. IUPAC name: 6-bromonaphthalene-1,2-dione. InChIKey: MXWZRRPNVLCHMY-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO2 |
|---|---|
| Molecular weight | 237.05 g/mol |
| IUPAC name | 6-bromonaphthalene-1,2-dione |
| InChIKey | MXWZRRPNVLCHMY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)C2=O)C=C1Br |
Computed by PubChem (NCBI)