Products 2065250-34-0

CAS 2065250-34-0 is the registry number for Trans-(1-benzyl-3-cyano-piperidin-4-yl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3S,4S)-1-benzyl-3-cyanopiperidin-4-yl]carbamate (CAS 2065250-34-0) is a chemical compound with the molecular formula C18H25N3O2 and a molecular weight of 315.4 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-1-benzyl-3-cyanopiperidin-4-yl]carbamate. InChIKey: BFTGPOIQJWKWKB-HOTGVXAUSA-N.

Identity
Molecular formulaC18H25N3O2
Molecular weight315.4 g/mol
IUPAC nametert-butyl N-[(3S,4S)-1-benzyl-3-cyanopiperidin-4-yl]carbamate
InChIKeyBFTGPOIQJWKWKB-HOTGVXAUSA-N
SMILESCC(C)(C)OC(=O)N[C@H]1CCN(C[C@@H]1C#N)CC2=CC=CC=C2

Computed by PubChem (NCBI)