Products 2066-89-9
CAS 2066-89-9 appears in our catalog under these names: Pasiniazid, Pasiniazid/ 98%, Pasiniazid 98%, Pasiniazid, 98%, 98%, Pasiniazid, 98.20%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 10g, 500mg, 1g, 10mM (in 1ml dmso), 50mg, 5g, 1mg, 100mg.
4-amino-2-hydroxybenzoic acid;pyridine-4-carbohydrazide (CAS 2066-89-9) is a chemical compound with the molecular formula C13H14N4O4 and a molecular weight of 290.27 g/mol. IUPAC name: 4-amino-2-hydroxybenzoic acid;pyridine-4-carbohydrazide. InChIKey: RKPHTRVPGYGVQD-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O4 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | 4-amino-2-hydroxybenzoic acid;pyridine-4-carbohydrazide |
| InChIKey | RKPHTRVPGYGVQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)O)C(=O)O.C1=CN=CC=C1C(=O)NN |
Computed by PubChem (NCBI)