CAS 74772-07-9 appears in our catalog under these names: Ethyl 1-methyl-5-((2-nitrophenyl)amino)-1H-pyrazole-4-carboxylate, 98%, Ethyl 1–methyl–5–((2–nitrophenyl)amino)–1H–pyrazole–4–carboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 250mg.
Ethyl 1-methyl-5-(2-nitroanilino)pyrazole-4-carboxylate (CAS 74772-07-9) is a chemical compound with the molecular formula C13H14N4O4 and a molecular weight of 290.27 g/mol. IUPAC name: ethyl 1-methyl-5-(2-nitroanilino)pyrazole-4-carboxylate. InChIKey: ZSGJABYQNHABCH-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O4 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | ethyl 1-methyl-5-(2-nitroanilino)pyrazole-4-carboxylate |
| InChIKey | ZSGJABYQNHABCH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C)NC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)