CAS 206647-35-0 appears in our catalog under these names: (1,1'–Biphenyl)–2,2',4,4'–tetracarboxylic acid, [1,1'-Biphenyl]-2,2',4,4'-tetracarboxylic acid 98%, [1,1'-Biphenyl]-2,2',4,4'-tetracarboxylic acid, 98%, 98%, [1,1'-Biphenyl]-2,2',4,4'-tetracarboxylic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4-(2,4-dicarboxyphenyl)benzene-1,3-dicarboxylic acid (CAS 206647-35-0) is a chemical compound with the molecular formula C16H10O8 and a molecular weight of 330.24 g/mol. IUPAC name: 4-(2,4-dicarboxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: MAQQETDJGIXPQI-UHFFFAOYSA-N.
| Molecular formula | C16H10O8 |
|---|---|
| Molecular weight | 330.24 g/mol |
| IUPAC name | 4-(2,4-dicarboxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | MAQQETDJGIXPQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)C2=C(C=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)