CAS 2066546-05-0 is the registry number for 5-Bromo-2,3-dihydro-1H-indole-6-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-2,3-dihydro-1H-indole-6-sulfonamide (CAS 2066546-05-0) is a chemical compound with the molecular formula C8H9BrN2O2S and a molecular weight of 277.14 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1H-indole-6-sulfonamide. InChIKey: SZBLIZSUBDJGIB-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O2S |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1H-indole-6-sulfonamide |
| InChIKey | SZBLIZSUBDJGIB-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)