CAS 2299065-06-6 appears in our catalog under these names: 5-Bromo-2-(propylthio)-4-pyrimidinecarboxylic Acid, 5-BROMO-2-(PROPYLSULFANYL)PYRIMIDINE-4-CARBOXYLIC ACID, ≥95%, ≥95%. Offered by: TRC, Chemat. Available pack sizes: 750mg, 100mg, 250mg, 1g.
5-bromo-2-propylsulfanylpyrimidine-4-carboxylic acid (CAS 2299065-06-6) is a chemical compound with the molecular formula C8H9BrN2O2S and a molecular weight of 277.14 g/mol. IUPAC name: 5-bromo-2-propylsulfanylpyrimidine-4-carboxylic acid. InChIKey: DPMKNPXRKYEBTP-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O2S |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | 5-bromo-2-propylsulfanylpyrimidine-4-carboxylic acid |
| InChIKey | DPMKNPXRKYEBTP-UHFFFAOYSA-N |
| SMILES | CCCSC1=NC=C(C(=N1)C(=O)O)Br |
Computed by PubChem (NCBI)