CAS 206761-84-4 appears in our catalog under these names: 3-Phenoxybenzhydrazide, 98%, 3-Phenoxybenzohydrazide 98%, 3-PHENOXYBENZHYDRAZIDE, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
3-phenoxybenzohydrazide (CAS 206761-84-4) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 3-phenoxybenzohydrazide. InChIKey: AZEXBWWYRSXTTN-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 3-phenoxybenzohydrazide |
| InChIKey | AZEXBWWYRSXTTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(=O)NN |
Computed by PubChem (NCBI)