CAS 206761-91-3 appears in our catalog under these names: 2,4,6–Trifluorophenyl Isothiocyanate, 1,3,5-Trifluoro-2-isothiocyanatobenzene 97%, 2,4,6-Trifluorophenylisothiocyanate, 99%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
1,3,5-trifluoro-2-isothiocyanatobenzene (CAS 206761-91-3) is a chemical compound with the molecular formula C7H2F3NS and a molecular weight of 189.16 g/mol. IUPAC name: 1,3,5-trifluoro-2-isothiocyanatobenzene. InChIKey: JPISVBDECFJHDB-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NS |
|---|---|
| Molecular weight | 189.16 g/mol |
| IUPAC name | 1,3,5-trifluoro-2-isothiocyanatobenzene |
| InChIKey | JPISVBDECFJHDB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)N=C=S)F)F |
Computed by PubChem (NCBI)