CAS 362690-55-9 is the registry number for 1,2,5-Trifluoro-3-isothiocyanatobenzene, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1,2,5-trifluoro-3-isothiocyanatobenzene (CAS 362690-55-9) is a chemical compound with the molecular formula C7H2F3NS and a molecular weight of 189.16 g/mol. IUPAC name: 1,2,5-trifluoro-3-isothiocyanatobenzene. InChIKey: UCYBFTISLFMERT-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NS |
|---|---|
| Molecular weight | 189.16 g/mol |
| IUPAC name | 1,2,5-trifluoro-3-isothiocyanatobenzene |
| InChIKey | UCYBFTISLFMERT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N=C=S)F)F)F |
Computed by PubChem (NCBI)