CAS 2068138-04-3 appears in our catalog under these names: (3R,4S)-Rel-4-amino-1-methylpyrrolidin-3-ol dihydrochloride, 95%, (3R,4S)-Rel-4-amino-1-methylpyrrolidin-3-ol dihydrochloride, 97%, (3R,4S)-Rel-4-amino-1-methylpyrrolidin-3-ol dihydrochloride, 97%, 97%, (3R,4S)-4-Amino-1-methylpyrrolidin-3-ol dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 500mg.
(3R,4S)-4-amino-1-methylpyrrolidin-3-ol;dihydrochloride (CAS 2068138-04-3) is a chemical compound with the molecular formula C5H14Cl2N2O and a molecular weight of 189.08 g/mol. IUPAC name: (3R,4S)-4-amino-1-methylpyrrolidin-3-ol;dihydrochloride. InChIKey: KWYWZFXGUYRWAT-YAQRUTEZSA-N.
| Molecular formula | C5H14Cl2N2O |
|---|---|
| Molecular weight | 189.08 g/mol |
| IUPAC name | (3R,4S)-4-amino-1-methylpyrrolidin-3-ol;dihydrochloride |
| InChIKey | KWYWZFXGUYRWAT-YAQRUTEZSA-N |
| SMILES | CN1C[C@@H]([C@@H](C1)O)N.Cl.Cl |
Computed by PubChem (NCBI)