CAS 2089245-64-5 is the registry number for Rac-(3r,4r)-4-amino-1-methyl-3-pyrrolidinol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
(3R,4R)-4-amino-1-methylpyrrolidin-3-ol;dihydrochloride (CAS 2089245-64-5) is a chemical compound with the molecular formula C5H14Cl2N2O and a molecular weight of 189.08 g/mol. IUPAC name: (3R,4R)-4-amino-1-methylpyrrolidin-3-ol;dihydrochloride. InChIKey: KWYWZFXGUYRWAT-ALUAXPQUSA-N.
| Molecular formula | C5H14Cl2N2O |
|---|---|
| Molecular weight | 189.08 g/mol |
| IUPAC name | (3R,4R)-4-amino-1-methylpyrrolidin-3-ol;dihydrochloride |
| InChIKey | KWYWZFXGUYRWAT-ALUAXPQUSA-N |
| SMILES | CN1C[C@H]([C@@H](C1)O)N.Cl.Cl |
Computed by PubChem (NCBI)