Products 2068867-65-0
CAS 2068867-65-0 is the registry number for BAR-072. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,5-dihydroxy-N-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]benzamide (CAS 2068867-65-0) is a chemical compound with the molecular formula C18H13N3O6 and a molecular weight of 367.3 g/mol. IUPAC name: 2,5-dihydroxy-N-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]benzamide. InChIKey: UWGONYFTAALZSO-VXLYETTFSA-N.
| Molecular formula | C18H13N3O6 |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | 2,5-dihydroxy-N-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
| InChIKey | UWGONYFTAALZSO-VXLYETTFSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)/C=N/NC(=O)C3=C(C=CC(=C3)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)