Products 2525175-90-8
CAS 2525175-90-8 is the registry number for Tyrosinase-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[1-[(5-hydroxy-4-oxopyran-2-yl)methyl]triazol-4-yl]methoxy]chromen-2-one (CAS 2525175-90-8) is a chemical compound with the molecular formula C18H13N3O6 and a molecular weight of 367.3 g/mol. IUPAC name: 4-[[1-[(5-hydroxy-4-oxopyran-2-yl)methyl]triazol-4-yl]methoxy]chromen-2-one. InChIKey: QZGMNWXEWODPIB-UHFFFAOYSA-N.
| Molecular formula | C18H13N3O6 |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | 4-[[1-[(5-hydroxy-4-oxopyran-2-yl)methyl]triazol-4-yl]methoxy]chromen-2-one |
| InChIKey | QZGMNWXEWODPIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)O2)OCC3=CN(N=N3)CC4=CC(=O)C(=CO4)O |
Computed by PubChem (NCBI)
Synonyms:
Tyrosinase-IN-5, orb1688610