CAS 2069-47-8 appears in our catalog under these names: 6-Chloro-2-(4-fluorophenyl)imidazo(1,2-a)pyridine, 6-Chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridine, ≥95%, ≥95%, 6-Chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridine, 90%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 50mg, 250mg, 500mg.
6-chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridine (CAS 2069-47-8) is a chemical compound with the molecular formula C13H8ClFN2 and a molecular weight of 246.67 g/mol. IUPAC name: 6-chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridine. InChIKey: BAMACVXNZHBYIR-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFN2 |
|---|---|
| Molecular weight | 246.67 g/mol |
| IUPAC name | 6-chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridine |
| InChIKey | BAMACVXNZHBYIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C=C(C=CC3=N2)Cl)F |
Computed by PubChem (NCBI)