Products 940656-93-9
CAS 940656-93-9 is the registry number for 2-(2-Chloro-6-fluorophenyl)-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-chloro-6-fluorophenyl)-1H-benzimidazole (CAS 940656-93-9) is a chemical compound with the molecular formula C13H8ClFN2 and a molecular weight of 246.67 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)-1H-benzimidazole. InChIKey: ZLRTXCHFIYZEMI-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFN2 |
|---|---|
| Molecular weight | 246.67 g/mol |
| IUPAC name | 2-(2-chloro-6-fluorophenyl)-1H-benzimidazole |
| InChIKey | ZLRTXCHFIYZEMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=C(C=CC=C3Cl)F |
Computed by PubChem (NCBI)