CAS 20691-71-8 appears in our catalog under these names: 3–AminoN,N–dimethyl4–nitroaniline, 3-Amino-N,N-dimethyl-4-nitroaniline, N1,N1-Dimethyl-4-nitrobenzene-1,3-diamine, 95%, 95%, N1,N1-Dimethyl-4-nitrobenzene-1,3-diamine, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 10g, 1g.
1-N,1-N-dimethyl-4-nitrobenzene-1,3-diamine (CAS 20691-71-8) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: 1-N,1-N-dimethyl-4-nitrobenzene-1,3-diamine. InChIKey: WJTOMXLUNDWLCY-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 1-N,1-N-dimethyl-4-nitrobenzene-1,3-diamine |
| InChIKey | WJTOMXLUNDWLCY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)