Products 207231-24-1
CAS 207231-24-1 is the registry number for Ethyl 4-chloro-6,7,8-trifluoroquinoline-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
Ethyl 4-chloro-6,7,8-trifluoroquinoline-3-carboxylate (CAS 207231-24-1) is a chemical compound with the molecular formula C12H7ClF3NO2 and a molecular weight of 289.64 g/mol. IUPAC name: ethyl 4-chloro-6,7,8-trifluoroquinoline-3-carboxylate. InChIKey: WCFMOGCTVPWEFW-UHFFFAOYSA-N.
| Molecular formula | C12H7ClF3NO2 |
|---|---|
| Molecular weight | 289.64 g/mol |
| IUPAC name | ethyl 4-chloro-6,7,8-trifluoroquinoline-3-carboxylate |
| InChIKey | WCFMOGCTVPWEFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC(=C(C(=C2N=C1)F)F)F)Cl |
Computed by PubChem (NCBI)