CAS 69045-89-2 appears in our catalog under these names: 4-((3-Chloro-5-trifluoromethylpyridin-2-yl)oxy)phenol, Haloxyfop-phenol, Haloxyfop-phenol Metabolite. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 100mg, 25mg, 250mg, 1x25mg.
4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenol (CAS 69045-89-2) is a chemical compound with the molecular formula C12H7ClF3NO2 and a molecular weight of 289.64 g/mol. IUPAC name: 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenol. InChIKey: NMJNUBBLJFJUKE-UHFFFAOYSA-N.
| Molecular formula | C12H7ClF3NO2 |
|---|---|
| Molecular weight | 289.64 g/mol |
| IUPAC name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenol |
| InChIKey | NMJNUBBLJFJUKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)