CAS 20727-99-5 is the registry number for Metaraminol Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1R,2R)-2-amino-1-hydroxypropyl]benzene-1,2-diol (CAS 20727-99-5) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: 4-[(1R,2R)-2-amino-1-hydroxypropyl]benzene-1,2-diol. InChIKey: GEFQWZLICWMTKF-ANLVUFKYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 4-[(1R,2R)-2-amino-1-hydroxypropyl]benzene-1,2-diol |
| InChIKey | GEFQWZLICWMTKF-ANLVUFKYSA-N |
| SMILES | C[C@H]([C@@H](C1=CC(=C(C=C1)O)O)O)N |
Computed by PubChem (NCBI)