CAS 20728-79-4 is the registry number for 4-(3-methoxyphenyl)aniline, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
(2R,3S)-8-benzyl-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (CAS 20728-79-4) is a chemical compound with the molecular formula C22H20O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2R,3S)-8-benzyl-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol. InChIKey: JXJNWLGWPXGNIK-LEWJYISDSA-N.
| Molecular formula | C22H20O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2R,3S)-8-benzyl-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| InChIKey | JXJNWLGWPXGNIK-LEWJYISDSA-N |
| SMILES | C1[C@@H]([C@H](OC2=C1C(=CC(=C2CC3=CC=CC=C3)O)O)C4=CC(=C(C=C4)O)O)O |
Computed by PubChem (NCBI)