Products 23733-95-1
CAS 23733-95-1 is the registry number for trans-3'-O-Benzoyl-4'-O-methylkhellactone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(10-methoxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) benzoate (CAS 23733-95-1) is a chemical compound with the molecular formula C22H20O6 and a molecular weight of 380.4 g/mol. IUPAC name: (10-methoxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) benzoate. InChIKey: QVMVCBJWWVINMQ-UHFFFAOYSA-N.
| Molecular formula | C22H20O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (10-methoxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) benzoate |
| InChIKey | QVMVCBJWWVINMQ-UHFFFAOYSA-N |
| SMILES | CC1(C(C(C2=C(O1)C=CC3=C2OC(=O)C=C3)OC)OC(=O)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)