Products 2074614-56-3
CAS 2074614-56-3 is the registry number for Sumatriptan EP Impurity G. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-1-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)methanesulfonamide (CAS 2074614-56-3) is a chemical compound with the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. IUPAC name: N-methyl-1-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)methanesulfonamide. InChIKey: MDLJZBUGPSOPKK-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O2S |
|---|---|
| Molecular weight | 293.39 g/mol |
| IUPAC name | N-methyl-1-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)methanesulfonamide |
| InChIKey | MDLJZBUGPSOPKK-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC2=C(C=C1)NC3=C2CCN(C3)C |
Computed by PubChem (NCBI)