CAS 2394492-31-8 is the registry number for 3-(((1-Methyl-1H-indazol-6-yl)methyl)amino)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1-methylindazol-6-yl)methyl]-1,1-dioxothian-3-amine (CAS 2394492-31-8) is a chemical compound with the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. IUPAC name: N-[(1-methylindazol-6-yl)methyl]-1,1-dioxothian-3-amine. InChIKey: DTEIIVLFOKJSDI-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O2S |
|---|---|
| Molecular weight | 293.39 g/mol |
| IUPAC name | N-[(1-methylindazol-6-yl)methyl]-1,1-dioxothian-3-amine |
| InChIKey | DTEIIVLFOKJSDI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)CNC3CCCS(=O)(=O)C3)C=N1 |
Computed by PubChem (NCBI)