Products 20748-66-7
CAS 20748-66-7 is the registry number for Propofol Impurity 19. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3,6-di(propan-2-yl)benzene-1,2-diol (CAS 20748-66-7) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: 3,6-di(propan-2-yl)benzene-1,2-diol. InChIKey: GSYRNBLFBPODTD-UHFFFAOYSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 3,6-di(propan-2-yl)benzene-1,2-diol |
| InChIKey | GSYRNBLFBPODTD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C=C1)C(C)C)O)O |
Computed by PubChem (NCBI)
Synonyms:
Pyrocatechol, 3,6-diisopropyl-, 1,2-Benzenediol, 3,6-bis(1-methylethyl)-, 3,6-Bis(1-methylethyl)-1,2-benzenediol, 3,6-di(propan-2-yl)benzene-1,2-diol, 3,6-Diisopropylpyrocatechol, Pyrocatechol, 3,6-(diisopropyl)-, 3,6-(Diisopropyl)pyrocatechol, Pyrocatechol,6-(diisopropyl)-, 1, 3,6-bis(1-methylethyl)-, GSYRNBLFBPODTD-UHFFFAOYSA-N