Products 207516-27-6
CAS 207516-27-6 is the registry number for Methyl 3,6-Dibromo-9H-fluorene-9-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3,6-dibromo-9H-fluorene-9-carboxylate (CAS 207516-27-6) is a chemical compound with the molecular formula C15H10Br2O2 and a molecular weight of 382.05 g/mol. IUPAC name: methyl 3,6-dibromo-9H-fluorene-9-carboxylate. InChIKey: KUPLGCHECOHBCQ-UHFFFAOYSA-N.
| Molecular formula | C15H10Br2O2 |
|---|---|
| Molecular weight | 382.05 g/mol |
| IUPAC name | methyl 3,6-dibromo-9H-fluorene-9-carboxylate |
| InChIKey | KUPLGCHECOHBCQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)