CAS 207556-12-5 is the registry number for METHYL-13C TRIFLUOROMETHANESULFONATE, &. Offered by: Sigma-Aldrich. Available pack sizes: 1G.
(113C)methyl trifluoromethanesulfonate (CAS 207556-12-5) is a chemical compound with the molecular formula C2H3F3O3S and a molecular weight of 165.10 g/mol. IUPAC name: (113C)methyl trifluoromethanesulfonate. InChIKey: OIRDBPQYVWXNSJ-OUBTZVSYSA-N.
| Molecular formula | C2H3F3O3S |
|---|---|
| Molecular weight | 165.10 g/mol |
| IUPAC name | (113C)methyl trifluoromethanesulfonate |
| InChIKey | OIRDBPQYVWXNSJ-OUBTZVSYSA-N |
| SMILES | [13CH3]OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)