CAS 73900-07-9 appears in our catalog under these names: METHYL-D3 TRIFLUOROMETHANE SULFONATE, 9&, Methyl-d3 triflate, 95%, Methyl trifluoromethanesulfonate-d3, 99.99%. Offered by: Sigma-Aldrich, Combi-blocks, MedChemExpress. Available pack sizes: 5G, 1g, 5 g, 1 g.
Trideuteriomethyl trifluoromethanesulfonate (CAS 73900-07-9) is a chemical compound with the molecular formula C2H3F3O3S and a molecular weight of 167.12 g/mol. IUPAC name: trideuteriomethyl trifluoromethanesulfonate. InChIKey: OIRDBPQYVWXNSJ-FIBGUPNXSA-N.
| Molecular formula | C2H3F3O3S |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | trideuteriomethyl trifluoromethanesulfonate |
| InChIKey | OIRDBPQYVWXNSJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)