CAS 2077990-05-5 is the registry number for 4-Hydroxy-2,8-dimethylquinoline-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,8-dimethyl-4-oxo-1H-quinoline-7-carboxylic acid (CAS 2077990-05-5) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 2,8-dimethyl-4-oxo-1H-quinoline-7-carboxylic acid. InChIKey: OFHQPSUPCYEPFB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2,8-dimethyl-4-oxo-1H-quinoline-7-carboxylic acid |
| InChIKey | OFHQPSUPCYEPFB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C(=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)