Products 2077990-05-5

CAS 2077990-05-5 is the registry number for 4-Hydroxy-2,8-dimethylquinoline-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,8-dimethyl-4-oxo-1H-quinoline-7-carboxylic acid (CAS 2077990-05-5) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 2,8-dimethyl-4-oxo-1H-quinoline-7-carboxylic acid. InChIKey: OFHQPSUPCYEPFB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO3
Molecular weight217.22 g/mol
IUPAC name2,8-dimethyl-4-oxo-1H-quinoline-7-carboxylic acid
InChIKeyOFHQPSUPCYEPFB-UHFFFAOYSA-N
SMILESCC1=CC(=O)C2=C(N1)C(=C(C=C2)C(=O)O)C

Computed by PubChem (NCBI)