CAS 20787-28-4 is the registry number for 2-O-Acetyl-1,6-anhydro-3,4-O-isopropylidene-β-D-galactopyranose. Offered by: Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
[(1R,2S,6S,7R,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl] acetate (CAS 20787-28-4) is a chemical compound with the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. IUPAC name: [(1R,2S,6S,7R,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl] acetate. InChIKey: QGDNGULCPVORBS-SOYHJAILSA-N.
| Molecular formula | C11H16O6 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | [(1R,2S,6S,7R,8R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl] acetate |
| InChIKey | QGDNGULCPVORBS-SOYHJAILSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@H]([C@H]3CO[C@@H]1O3)OC(O2)(C)C |
Computed by PubChem (NCBI)