CAS 31862-39-2 is the registry number for Dimethyl 3,3-diacetylpentanedioate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl 3,3-diacetylpentanedioate (CAS 31862-39-2) is a chemical compound with the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. IUPAC name: dimethyl 3,3-diacetylpentanedioate. InChIKey: JSAWBBQOXIZJNI-UHFFFAOYSA-N.
| Molecular formula | C11H16O6 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | dimethyl 3,3-diacetylpentanedioate |
| InChIKey | JSAWBBQOXIZJNI-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CC(=O)OC)(CC(=O)OC)C(=O)C |
Computed by PubChem (NCBI)