CAS 20795-53-3 appears in our catalog under these names: 3-Phenylcyclohexanone, 3-Phenylcyclohexanone 98%, 3-Phenylcyclohexanone, 95%, 3-Phenyl-cyclohexanone, 96%, 3-Phenylcyclohexanone, 98%, 98%. Offered by: TRC, Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 500mg, 100mg, 5g, 10g.
3-phenylcyclohexan-1-one (CAS 20795-53-3) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 3-phenylcyclohexan-1-one. InChIKey: CJAUDSQXFVZPTO-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 3-phenylcyclohexan-1-one |
| InChIKey | CJAUDSQXFVZPTO-UHFFFAOYSA-N |
| SMILES | C1CC(CC(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)