CAS 5037-63-8 appears in our catalog under these names: 5,8-Dimethyl-1,2,3,4-tetrahydronaphthalen-1-one, 95%, 5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
5,8-dimethyl-3,4-dihydro-2H-naphthalen-1-one (CAS 5037-63-8) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 5,8-dimethyl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: ZSMGKPHICFZGQU-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 5,8-dimethyl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | ZSMGKPHICFZGQU-UHFFFAOYSA-N |
| SMILES | CC1=C2CCCC(=O)C2=C(C=C1)C |
Computed by PubChem (NCBI)