CAS 207974-13-8 appears in our catalog under these names: 1,1'-(Oxydimethanediyl)bis(2,4-dichlorobenzene) (Bis-(2,4-dichlorobenzyl) Ether), 2,4-Dichloro-1-{((2,4-dichlorophenyl)methoxy)methyl}benzene, 2,2,4,4-Tetrachlorodibenzylether 97%, 4,4-(Oxybis(methylene))bis(1,3-dichlorobenzene), 95%, 95%. Offered by: Mikromol, Biosynth, Ambeed, Chemat. Available pack sizes: 25mg, 100mg, 50mg, 250mg, 1000mg, 500mg, 1g, 5g.
2,4-dichloro-1-[(2,4-dichlorophenyl)methoxymethyl]benzene (CAS 207974-13-8) is a chemical compound with the molecular formula C14H10Cl4O and a molecular weight of 336.0 g/mol. IUPAC name: 2,4-dichloro-1-[(2,4-dichlorophenyl)methoxymethyl]benzene. InChIKey: NWYHVMDKERUNLM-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl4O |
|---|---|
| Molecular weight | 336.0 g/mol |
| IUPAC name | 2,4-dichloro-1-[(2,4-dichlorophenyl)methoxymethyl]benzene |
| InChIKey | NWYHVMDKERUNLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)COCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)