CAS 207974-18-3 appears in our catalog under these names: 2'-Fluoro-5'-(trifluoromethyl)propiophenone, 95%, 2'-Fluoro-5'-(trifluoromethyl)propiophenone, ≥97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g.
1-[2-fluoro-5-(trifluoromethyl)phenyl]propan-1-one (CAS 207974-18-3) is a chemical compound with the molecular formula C10H8F4O and a molecular weight of 220.16 g/mol. IUPAC name: 1-[2-fluoro-5-(trifluoromethyl)phenyl]propan-1-one. InChIKey: SCKAMDGXXQFMFY-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O |
|---|---|
| Molecular weight | 220.16 g/mol |
| IUPAC name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]propan-1-one |
| InChIKey | SCKAMDGXXQFMFY-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=CC(=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)