Products 289891-94-7
CAS 289891-94-7 is the registry number for Benzene, 1-fluoro-2-(2-propen-1-yloxy)-4-(trifluoromethyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-fluoro-2-prop-2-enoxy-4-(trifluoromethyl)benzene (CAS 289891-94-7) is a chemical compound with the molecular formula C10H8F4O and a molecular weight of 220.16 g/mol. IUPAC name: 1-fluoro-2-prop-2-enoxy-4-(trifluoromethyl)benzene. InChIKey: HYHVWBKASQVRDA-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O |
|---|---|
| Molecular weight | 220.16 g/mol |
| IUPAC name | 1-fluoro-2-prop-2-enoxy-4-(trifluoromethyl)benzene |
| InChIKey | HYHVWBKASQVRDA-UHFFFAOYSA-N |
| SMILES | C=CCOC1=C(C=CC(=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)