CAS 207976-79-2 is the registry number for N-(2-(3,5-Dimethylbenzoyl)phenyl)acetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-[2-(3,5-dimethylbenzoyl)phenyl]acetamide (CAS 207976-79-2) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: N-[2-(3,5-dimethylbenzoyl)phenyl]acetamide. InChIKey: CATGJTGJTSYEBF-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | N-[2-(3,5-dimethylbenzoyl)phenyl]acetamide |
| InChIKey | CATGJTGJTSYEBF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)C2=CC=CC=C2NC(=O)C)C |
Computed by PubChem (NCBI)