CAS 2080361-24-4 is the registry number for tert-Butyl 2-(4,6-dichloropyrimidin-2-yl)pyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.
Tert-butyl 2-(4,6-dichloropyrimidin-2-yl)pyrrolidine-1-carboxylate (CAS 2080361-24-4) is a chemical compound with the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. IUPAC name: tert-butyl 2-(4,6-dichloropyrimidin-2-yl)pyrrolidine-1-carboxylate. InChIKey: FMHYTFLQTBJQTO-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2N3O2 |
|---|---|
| Molecular weight | 318.20 g/mol |
| IUPAC name | tert-butyl 2-(4,6-dichloropyrimidin-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | FMHYTFLQTBJQTO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)