CAS 2306270-58-4 is the registry number for tert-Butyl 3-(3,6-dichloropyridazin-4-yl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(3,6-dichloropyridazin-4-yl)pyrrolidine-1-carboxylate (CAS 2306270-58-4) is a chemical compound with the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. IUPAC name: tert-butyl 3-(3,6-dichloropyridazin-4-yl)pyrrolidine-1-carboxylate. InChIKey: ZDXNGAIHNNDRJF-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2N3O2 |
|---|---|
| Molecular weight | 318.20 g/mol |
| IUPAC name | tert-butyl 3-(3,6-dichloropyridazin-4-yl)pyrrolidine-1-carboxylate |
| InChIKey | ZDXNGAIHNNDRJF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)