CAS 2080361-29-9 is the registry number for 4,6-Dichloro-2-(piperidin-2-yl)pyrimidine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-2-piperidin-2-ylpyrimidine;hydrochloride (CAS 2080361-29-9) is a chemical compound with the molecular formula C9H12Cl3N3 and a molecular weight of 268.6 g/mol. IUPAC name: 4,6-dichloro-2-piperidin-2-ylpyrimidine;hydrochloride. InChIKey: VTJSUUHMSKHKNN-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N3 |
|---|---|
| Molecular weight | 268.6 g/mol |
| IUPAC name | 4,6-dichloro-2-piperidin-2-ylpyrimidine;hydrochloride |
| InChIKey | VTJSUUHMSKHKNN-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=NC(=CC(=N2)Cl)Cl.Cl |
Computed by PubChem (NCBI)