CAS 91003-86-0 appears in our catalog under these names: 2-(5-Chloro-1h-benzo[d]imidazol-2-yl)ethanamine dihydrochloride, 97%, 2-(5-Chloro-1H-benzo(d)imidazol-2-yl)ethanamine dihydrochloride, 95+%, 2-(5-Chloro-1H-benzimidazol-2-yl)ethanamine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g.
2-(6-chloro-1H-benzimidazol-2-yl)ethanamine;dihydrochloride (CAS 91003-86-0) is a chemical compound with the molecular formula C9H12Cl3N3 and a molecular weight of 268.6 g/mol. IUPAC name: 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine;dihydrochloride. InChIKey: SEOYUNGLAMIHQQ-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N3 |
|---|---|
| Molecular weight | 268.6 g/mol |
| IUPAC name | 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | SEOYUNGLAMIHQQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)