CAS 2080436-77-5 is the registry number for Adenosine Impurity 27. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4,4-dimethyloxolan-3-ol (CAS 2080436-77-5) is a chemical compound with the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. IUPAC name: (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4,4-dimethyloxolan-3-ol. InChIKey: LSECKSJDFOAUKI-VISXPRAWSA-N.
| Molecular formula | C12H18N6O3 |
|---|---|
| Molecular weight | 294.31 g/mol |
| IUPAC name | (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4,4-dimethyloxolan-3-ol |
| InChIKey | LSECKSJDFOAUKI-VISXPRAWSA-N |
| SMILES | CC1([C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)N)N)CO)O)C |
Computed by PubChem (NCBI)