CAS 83061-20-5 is the registry number for 2-Amino-2’-deoxy-N6,N6-dimethyl-2’-adenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (CAS 83061-20-5) is a chemical compound with the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. IUPAC name: (2R,3S,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol. InChIKey: BDQPWZYLQPUTEJ-XLPZGREQSA-N.
| Molecular formula | C12H18N6O3 |
|---|---|
| Molecular weight | 294.31 g/mol |
| IUPAC name | (2R,3S,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | BDQPWZYLQPUTEJ-XLPZGREQSA-N |
| SMILES | CN(C)C1=NC(=NC2=C1N=CN2[C@H]3C[C@@H]([C@H](O3)CO)O)N |
Computed by PubChem (NCBI)