Products 143460-23-5
CAS 143460-23-5 is the registry number for Oncopterin. Offered by: TargetMol. Available pack sizes: 1mg, 5mg, 25mg.
2-(3-aminopropylamino)-6-[(1R,2S)-1,2-dihydroxypropyl]-3H-pteridin-4-one (CAS 143460-23-5) is a chemical compound with the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. IUPAC name: 2-(3-aminopropylamino)-6-[(1R,2S)-1,2-dihydroxypropyl]-3H-pteridin-4-one. InChIKey: BBFMPNKVCFIPPX-RCOVLWMOSA-N.
| Molecular formula | C12H18N6O3 |
|---|---|
| Molecular weight | 294.31 g/mol |
| IUPAC name | 2-(3-aminopropylamino)-6-[(1R,2S)-1,2-dihydroxypropyl]-3H-pteridin-4-one |
| InChIKey | BBFMPNKVCFIPPX-RCOVLWMOSA-N |
| SMILES | C[C@@H]([C@@H](C1=CN=C2C(=N1)C(=O)NC(=N2)NCCCN)O)O |
Computed by PubChem (NCBI)