CAS 208051-67-6 is the registry number for Piroxicam Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-methoxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxylate (CAS 208051-67-6) is a chemical compound with the molecular formula C12H13NO5S and a molecular weight of 283.30 g/mol. IUPAC name: methyl 4-methoxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxylate. InChIKey: XIWCNJQBMDCBPC-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5S |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | methyl 4-methoxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxylate |
| InChIKey | XIWCNJQBMDCBPC-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C2=CC=CC=C2S1(=O)=O)OC)C(=O)OC |
Computed by PubChem (NCBI)