CAS 223646-24-0 appears in our catalog under these names: Topramezone Acid, 3-(4,5-Dihydroisoxazol-3-yl)-2-methyl-4-(methylsulfonyl)benzoic acid 98%, 3-(4,5-Dihydro-3-isoxazolyl)-2-methyl-4-(methylsulfonyl)benzoic acid, 98%, 98%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoic acid (CAS 223646-24-0) is a chemical compound with the molecular formula C12H13NO5S and a molecular weight of 283.30 g/mol. IUPAC name: 3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoic acid. InChIKey: JHIDHJCCPYAESR-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5S |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | 3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoic acid |
| InChIKey | JHIDHJCCPYAESR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C2=NOCC2)S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)